About N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine
N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine (PubChem CID 64850186) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine.
Molecular Properties
| Compound Name | N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine |
| PubChem CID | 64850186 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine |
| SMILES | C=COCCCNC1CC(OCC(C)C)C1(C)C |
| InChI | InChI=1S/C15H29NO2/c1-6-17-9-7-8-16-13-10-14(15(13,4)5)18-11-12(2)3/h6,12-14,16H,1,7-11H2,2-5H3 |
| InChIKey | SZVURGADTQISAC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine?
The IUPAC name of N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine (CID 64850186) is N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine.
What is the SMILES notation for N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine?
The canonical SMILES for N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine is C=COCCCNC1CC(OCC(C)C)C1(C)C.
What is the InChIKey of N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine?
The InChIKey is SZVURGADTQISAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-6-17-9-7-8-16-13-10-14(15(13,4)5)18-11-12(2)3/h6,12-14,16H,1,7-11H2,2-5H3.
What are the key properties of N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine?
N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine has a molecular weight of 255.40 g/mol, XLogP of 2.97, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethenoxypropyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine is sourced from PubChem (CID 64850186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).