C14H26F3NO2 — CID 64850406
2,2-dimethyl-3-(2-methylpropoxy)-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclobutan-1-amine (PubChem CID 64850406) has the molecular formula C14H26F3NO2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2-methylpropoxy)-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclobutan-1-amine.
| Compound Name | 2,2-dimethyl-3-(2-methylpropoxy)-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 64850406 |
| Molecular Formula | C14H26F3NO2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2,2-dimethyl-3-(2-methylpropoxy)-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclobutan-1-amine |
| SMILES | CC(C)COC1CC(NCCOCC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C14H26F3NO2/c1-10(2)8-20-12-7-11(13(12,3)4)18-5-6-19-9-14(15,16)17/h10-12,18H,5-9H2,1-4H3 |
| InChIKey | RYKZHLULFTXQCR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|