C13H19N3 — CID 64850452
(3aS,6aS)-5-(2-pyridin-4-ylethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole (PubChem CID 64850452) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (3aS,6aS)-5-(2-pyridin-4-ylethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-5-(2-pyridin-4-ylethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 64850452 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (3aS,6aS)-5-(2-pyridin-4-ylethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
| SMILES | c1cc(CCN2C[C@@H]3CCN[C@@H]3C2)ccn1 |
| InChI | InChI=1S/C13H19N3/c1-5-14-6-2-11(1)4-8-16-9-12-3-7-15-13(12)10-16/h1-2,5-6,12-13,15H,3-4,7-10H2/t12-,13+/m0/s1 |
| InChIKey | HMONKHMLEWUJKM-QWHCGFSZSA-N |
| XLogP | 0.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |