About N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide
N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide (PubChem CID 64850583) has the molecular formula C13H28N2O3S
and a molecular weight of 292.44 g/mol. Its IUPAC name is N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide |
| PubChem CID | 64850583 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide |
| SMILES | CC(C)COC1CC(NCCNS(C)(=O)=O)C1(C)C |
| InChI | InChI=1S/C13H28N2O3S/c1-10(2)9-18-12-8-11(13(12,3)4)14-6-7-15-19(5,16)17/h10-12,14-15H,6-9H2,1-5H3 |
| InChIKey | JBEHXNPJXYNTFT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide?
The IUPAC name of N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide (CID 64850583) is N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide.
What is the SMILES notation for N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide?
The canonical SMILES for N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide is CC(C)COC1CC(NCCNS(C)(=O)=O)C1(C)C.
What is the InChIKey of N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide?
The InChIKey is JBEHXNPJXYNTFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O3S/c1-10(2)9-18-12-8-11(13(12,3)4)14-6-7-15-19(5,16)17/h10-12,14-15H,6-9H2,1-5H3.
What are the key properties of N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide?
N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide has a molecular weight of 292.44 g/mol, XLogP of 0.96, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethyl]methanesulfonamide is sourced from PubChem (CID 64850583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).