About N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide
N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 64850603) has the molecular formula C15H32N2O3S
and a molecular weight of 320.50 g/mol. Its IUPAC name is N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide |
| PubChem CID | 64850603 |
| Molecular Formula | C15H32N2O3S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CC(C)COC1CC(NCC(C)(C)NS(C)(=O)=O)C1(C)C |
| InChI | InChI=1S/C15H32N2O3S/c1-11(2)9-20-13-8-12(15(13,5)6)16-10-14(3,4)17-21(7,18)19/h11-13,16-17H,8-10H2,1-7H3 |
| InChIKey | ZDKJNCYNKQGYOB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide?
The IUPAC name of N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide (CID 64850603) is N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide?
The canonical SMILES for N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide is CC(C)COC1CC(NCC(C)(C)NS(C)(=O)=O)C1(C)C.
What is the InChIKey of N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide?
The InChIKey is ZDKJNCYNKQGYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O3S/c1-11(2)9-20-13-8-12(15(13,5)6)16-10-14(3,4)17-21(7,18)19/h11-13,16-17H,8-10H2,1-7H3.
What are the key properties of N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide?
N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide has a molecular weight of 320.50 g/mol, XLogP of 1.74, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-2-methylpropan-2-yl]methanesulfonamide is sourced from PubChem (CID 64850603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).