About 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol
4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol (PubChem CID 64850719) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol |
| PubChem CID | 64850719 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol |
| SMILES | CCOC1CC(NC2CCC(O)CC2)C1(C)C |
| InChI | InChI=1S/C14H27NO2/c1-4-17-13-9-12(14(13,2)3)15-10-5-7-11(16)8-6-10/h10-13,15-16H,4-9H2,1-3H3 |
| InChIKey | QTMOPKGRUQMCPW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol?
The IUPAC name of 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol (CID 64850719) is 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol.
What is the SMILES notation for 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol?
The canonical SMILES for 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol is CCOC1CC(NC2CCC(O)CC2)C1(C)C.
What is the InChIKey of 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol?
The InChIKey is QTMOPKGRUQMCPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-4-17-13-9-12(14(13,2)3)15-10-5-7-11(16)8-6-10/h10-13,15-16H,4-9H2,1-3H3.
What are the key properties of 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol?
4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol has a molecular weight of 241.37 g/mol, XLogP of 2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]cyclohexan-1-ol is sourced from PubChem (CID 64850719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).