About N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine
N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64850750) has the molecular formula C15H26F3NO
and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine |
| PubChem CID | 64850750 |
| Molecular Formula | C15H26F3NO |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CCOC1CC(NC2CCCC(C(F)(F)F)C2)C1(C)C |
| InChI | InChI=1S/C15H26F3NO/c1-4-20-13-9-12(14(13,2)3)19-11-7-5-6-10(8-11)15(16,17)18/h10-13,19H,4-9H2,1-3H3 |
| InChIKey | LYYXMVWYFSELIS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine?
The IUPAC name of N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine (CID 64850750) is N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine.
What is the SMILES notation for N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine?
The canonical SMILES for N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine is CCOC1CC(NC2CCCC(C(F)(F)F)C2)C1(C)C.
What is the InChIKey of N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine?
The InChIKey is LYYXMVWYFSELIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26F3NO/c1-4-20-13-9-12(14(13,2)3)19-11-7-5-6-10(8-11)15(16,17)18/h10-13,19H,4-9H2,1-3H3.
What are the key properties of N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine?
N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine has a molecular weight of 293.37 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethoxy-2,2-dimethylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine is sourced from PubChem (CID 64850750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).