About 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide
2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide (PubChem CID 64850980) has the molecular formula C12H26N2O3S
and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide.
Molecular Properties
| Compound Name | 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide |
| PubChem CID | 64850980 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide |
| SMILES | CC(C)COC1CC(NCCS(N)(=O)=O)C1(C)C |
| InChI | InChI=1S/C12H26N2O3S/c1-9(2)8-17-11-7-10(12(11,3)4)14-5-6-18(13,15)16/h9-11,14H,5-8H2,1-4H3,(H2,13,15,16) |
| InChIKey | RYBCMOSGYITIBR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide?
The IUPAC name of 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide (CID 64850980) is 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide.
What is the SMILES notation for 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide?
The canonical SMILES for 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide is CC(C)COC1CC(NCCS(N)(=O)=O)C1(C)C.
What is the InChIKey of 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide?
The InChIKey is RYBCMOSGYITIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O3S/c1-9(2)8-17-11-7-10(12(11,3)4)14-5-6-18(13,15)16/h9-11,14H,5-8H2,1-4H3,(H2,13,15,16).
What are the key properties of 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide?
2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide has a molecular weight of 278.42 g/mol, XLogP of 0.70, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]ethanesulfonamide is sourced from PubChem (CID 64850980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).