C14H20N2O — CID 64851045
5-(oxan-4-yl)-1,2,3,4-tetrahydro-1,5-benzodiazepine (PubChem CID 64851045) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 5-(oxan-4-yl)-1,2,3,4-tetrahydro-1,5-benzodiazepine.
| Compound Name | 5-(oxan-4-yl)-1,2,3,4-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 64851045 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 5-(oxan-4-yl)-1,2,3,4-tetrahydro-1,5-benzodiazepine |
| SMILES | c1ccc2c(c1)NCCCN2C1CCOCC1 |
| InChI | InChI=1S/C14H20N2O/c1-2-5-14-13(4-1)15-8-3-9-16(14)12-6-10-17-11-7-12/h1-2,4-5,12,15H,3,6-11H2 |
| InChIKey | BUBWCUYRLNCZRL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |