C17H21ClN2O — CID 64851147
5-chloro-N-(3-ethoxy-2,2-dimethylcyclobutyl)quinolin-8-amine (PubChem CID 64851147) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 5-chloro-N-(3-ethoxy-2,2-dimethylcyclobutyl)quinolin-8-amine.
| Compound Name | 5-chloro-N-(3-ethoxy-2,2-dimethylcyclobutyl)quinolin-8-amine |
|---|---|
| PubChem CID | 64851147 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5-chloro-N-(3-ethoxy-2,2-dimethylcyclobutyl)quinolin-8-amine |
| SMILES | CCOC1CC(Nc2ccc(Cl)c3cccnc23)C1(C)C |
| InChI | InChI=1S/C17H21ClN2O/c1-4-21-15-10-14(17(15,2)3)20-13-8-7-12(18)11-6-5-9-19-16(11)13/h5-9,14-15,20H,4,10H2,1-3H3 |
| InChIKey | AAAPQWMGXJKZIW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |