About 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide
3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide (PubChem CID 64851156) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide.
Molecular Properties
| Compound Name | 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide |
| PubChem CID | 64851156 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNC1CC(OCC)C1(C)C |
| InChI | InChI=1S/C14H28N2O2/c1-5-8-16-13(17)7-9-15-11-10-12(18-6-2)14(11,3)4/h11-12,15H,5-10H2,1-4H3,(H,16,17) |
| InChIKey | VTXOGLLKHMCONO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide?
The IUPAC name of 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide (CID 64851156) is 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide.
What is the SMILES notation for 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide?
The canonical SMILES for 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide is CCCNC(=O)CCNC1CC(OCC)C1(C)C.
What is the InChIKey of 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide?
The InChIKey is VTXOGLLKHMCONO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2/c1-5-8-16-13(17)7-9-15-11-10-12(18-6-2)14(11,3)4/h11-12,15H,5-10H2,1-4H3,(H,16,17).
What are the key properties of 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide?
3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide has a molecular weight of 256.39 g/mol, XLogP of 1.70, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-N-propylpropanamide is sourced from PubChem (CID 64851156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).