About N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline
N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline (PubChem CID 64851332) has the molecular formula C15H22FNO3S
and a molecular weight of 315.41 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline.
Molecular Properties
| Compound Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline |
| PubChem CID | 64851332 |
| Molecular Formula | C15H22FNO3S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline |
| SMILES | CCOC1CC(Nc2cc(S(C)(=O)=O)ccc2F)C1(C)C |
| InChI | InChI=1S/C15H22FNO3S/c1-5-20-14-9-13(15(14,2)3)17-12-8-10(21(4,18)19)6-7-11(12)16/h6-8,13-14,17H,5,9H2,1-4H3 |
| InChIKey | LSVQDMSUFVFDQR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline?
The IUPAC name of N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline (CID 64851332) is N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline.
What is the SMILES notation for N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline?
The canonical SMILES for N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline is CCOC1CC(Nc2cc(S(C)(=O)=O)ccc2F)C1(C)C.
What is the InChIKey of N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline?
The InChIKey is LSVQDMSUFVFDQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FNO3S/c1-5-20-14-9-13(15(14,2)3)17-12-8-10(21(4,18)19)6-7-11(12)16/h6-8,13-14,17H,5,9H2,1-4H3.
What are the key properties of N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline?
N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline has a molecular weight of 315.41 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-fluoro-5-methylsulfonylaniline is sourced from PubChem (CID 64851332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).