About 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol
1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol (PubChem CID 64851362) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol |
| PubChem CID | 64851362 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol |
| SMILES | CCOC1CC(NCC(O)COC)C1(C)C |
| InChI | InChI=1S/C12H25NO3/c1-5-16-11-6-10(12(11,2)3)13-7-9(14)8-15-4/h9-11,13-14H,5-8H2,1-4H3 |
| InChIKey | BSOYXFWLNYTBFL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol?
The IUPAC name of 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol (CID 64851362) is 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol.
What is the SMILES notation for 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol?
The canonical SMILES for 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol is CCOC1CC(NCC(O)COC)C1(C)C.
What is the InChIKey of 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol?
The InChIKey is BSOYXFWLNYTBFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-5-16-11-6-10(12(11,2)3)13-7-9(14)8-15-4/h9-11,13-14H,5-8H2,1-4H3.
What are the key properties of 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol?
1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol has a molecular weight of 231.34 g/mol, XLogP of 0.79, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-methoxypropan-2-ol is sourced from PubChem (CID 64851362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).