About 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol
1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol (PubChem CID 64851584) has the molecular formula C14H29NO3
and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol |
| PubChem CID | 64851584 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CNC1CC(OCC(C)C)C1(C)C |
| InChI | InChI=1S/C14H29NO3/c1-10(2)8-18-13-6-12(14(13,3)4)15-7-11(16)9-17-5/h10-13,15-16H,6-9H2,1-5H3 |
| InChIKey | JESYOOXZYYVNEQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol?
The IUPAC name of 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol (CID 64851584) is 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol.
What is the SMILES notation for 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol?
The canonical SMILES for 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol is COCC(O)CNC1CC(OCC(C)C)C1(C)C.
What is the InChIKey of 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol?
The InChIKey is JESYOOXZYYVNEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO3/c1-10(2)8-18-13-6-12(14(13,3)4)15-7-11(16)9-17-5/h10-13,15-16H,6-9H2,1-5H3.
What are the key properties of 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol?
1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol has a molecular weight of 259.39 g/mol, XLogP of 1.42, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-3-methoxypropan-2-ol is sourced from PubChem (CID 64851584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).