C16H26N2 — CID 64851622
5-heptyl-1,2,3,4-tetrahydro-1,5-benzodiazepine (PubChem CID 64851622) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 5-heptyl-1,2,3,4-tetrahydro-1,5-benzodiazepine.
| Compound Name | 5-heptyl-1,2,3,4-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 64851622 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 5-heptyl-1,2,3,4-tetrahydro-1,5-benzodiazepine |
| SMILES | CCCCCCCN1CCCNc2ccccc21 |
| InChI | InChI=1S/C16H26N2/c1-2-3-4-5-8-13-18-14-9-12-17-15-10-6-7-11-16(15)18/h6-7,10-11,17H,2-5,8-9,12-14H2,1H3 |
| InChIKey | HCDAFYMCJATFKN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|