About 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide
3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide (PubChem CID 64851764) has the molecular formula C15H30N2O2
and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide |
| PubChem CID | 64851764 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide |
| SMILES | CC(C)COC1CC(NCCC(=O)N(C)C)C1(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-11(2)10-19-13-9-12(15(13,3)4)16-8-7-14(18)17(5)6/h11-13,16H,7-10H2,1-6H3 |
| InChIKey | HDQVDFYSSIBNQV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide?
The IUPAC name of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide (CID 64851764) is 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide is CC(C)COC1CC(NCCC(=O)N(C)C)C1(C)C.
What is the InChIKey of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide?
The InChIKey is HDQVDFYSSIBNQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O2/c1-11(2)10-19-13-9-12(15(13,3)4)16-8-7-14(18)17(5)6/h11-13,16H,7-10H2,1-6H3.
What are the key properties of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide?
3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide has a molecular weight of 270.42 g/mol, XLogP of 1.89, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N,N-dimethylpropanamide is sourced from PubChem (CID 64851764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).