About 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide
3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide (PubChem CID 64851770) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide.
Molecular Properties
| Compound Name | 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide |
| PubChem CID | 64851770 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNC1CC(OCC(C)C)C1(C)C |
| InChI | InChI=1S/C14H28N2O2/c1-10(2)9-18-12-8-11(14(12,3)4)16-7-6-13(17)15-5/h10-12,16H,6-9H2,1-5H3,(H,15,17) |
| InChIKey | MZJTYCXVUHZJAL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide?
The IUPAC name of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide (CID 64851770) is 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide.
What is the SMILES notation for 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide?
The canonical SMILES for 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide is CNC(=O)CCNC1CC(OCC(C)C)C1(C)C.
What is the InChIKey of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide?
The InChIKey is MZJTYCXVUHZJAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2/c1-10(2)9-18-12-8-11(14(12,3)4)16-7-6-13(17)15-5/h10-12,16H,6-9H2,1-5H3,(H,15,17).
What are the key properties of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide?
3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide has a molecular weight of 256.39 g/mol, XLogP of 1.55, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]-N-methylpropanamide is sourced from PubChem (CID 64851770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).