About 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide
3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide (PubChem CID 64851771) has the molecular formula C13H28N2O3S
and a molecular weight of 292.45 g/mol. Its IUPAC name is 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide |
| PubChem CID | 64851771 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide |
| SMILES | CC(C)COC1CC(NCCCS(N)(=O)=O)C1(C)C |
| InChI | InChI=1S/C13H28N2O3S/c1-10(2)9-18-12-8-11(13(12,3)4)15-6-5-7-19(14,16)17/h10-12,15H,5-9H2,1-4H3,(H2,14,16,17) |
| InChIKey | WYDQAFNOUUMNHA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide?
The IUPAC name of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide (CID 64851771) is 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide.
What is the SMILES notation for 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide?
The canonical SMILES for 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide is CC(C)COC1CC(NCCCS(N)(=O)=O)C1(C)C.
What is the InChIKey of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide?
The InChIKey is WYDQAFNOUUMNHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O3S/c1-10(2)9-18-12-8-11(13(12,3)4)15-6-5-7-19(14,16)17/h10-12,15H,5-9H2,1-4H3,(H2,14,16,17).
What are the key properties of 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide?
3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide has a molecular weight of 292.45 g/mol, XLogP of 1.09, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]propane-1-sulfonamide is sourced from PubChem (CID 64851771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).