C15H20F2N2O2 — CID 64851902
5-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-2,4-difluorobenzamide (PubChem CID 64851902) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 5-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-2,4-difluorobenzamide.
| Compound Name | 5-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 64851902 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 5-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-2,4-difluorobenzamide |
| SMILES | CCOC1CC(Nc2cc(C(N)=O)c(F)cc2F)C1(C)C |
| InChI | InChI=1S/C15H20F2N2O2/c1-4-21-13-7-12(15(13,2)3)19-11-5-8(14(18)20)9(16)6-10(11)17/h5-6,12-13,19H,4,7H2,1-3H3,(H2,18,20) |
| InChIKey | JPQPGOGIQKALEY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |