About N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline
N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline (PubChem CID 64852334) has the molecular formula C18H29NO
and a molecular weight of 275.44 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline.
Molecular Properties
| Compound Name | N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline |
| PubChem CID | 64852334 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline |
| SMILES | CCc1ccccc1NC1CC(OCC(C)C)C1(C)C |
| InChI | InChI=1S/C18H29NO/c1-6-14-9-7-8-10-15(14)19-16-11-17(18(16,4)5)20-12-13(2)3/h7-10,13,16-17,19H,6,11-12H2,1-5H3 |
| InChIKey | BXTUCXRQQKRCBX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline?
The IUPAC name of N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline (CID 64852334) is N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline.
What is the SMILES notation for N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline?
The canonical SMILES for N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline is CCc1ccccc1NC1CC(OCC(C)C)C1(C)C.
What is the InChIKey of N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline?
The InChIKey is BXTUCXRQQKRCBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO/c1-6-14-9-7-8-10-15(14)19-16-11-17(18(16,4)5)20-12-13(2)3/h7-10,13,16-17,19H,6,11-12H2,1-5H3.
What are the key properties of N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline?
N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline has a molecular weight of 275.44 g/mol, XLogP of 4.50, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2-ethylaniline is sourced from PubChem (CID 64852334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).