About N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine
N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine (PubChem CID 64852345) has the molecular formula C15H29NO3S
and a molecular weight of 303.47 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 64852345 |
| Molecular Formula | C15H29NO3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CC(C)COC1CC(NC2(C)CCS(=O)(=O)C2)C1(C)C |
| InChI | InChI=1S/C15H29NO3S/c1-11(2)9-19-13-8-12(14(13,3)4)16-15(5)6-7-20(17,18)10-15/h11-13,16H,6-10H2,1-5H3 |
| InChIKey | IZDQXPZMLXUCFI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine (CID 64852345) is N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine is CC(C)COC1CC(NC2(C)CCS(=O)(=O)C2)C1(C)C.
What is the InChIKey of N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is IZDQXPZMLXUCFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO3S/c1-11(2)9-19-13-8-12(14(13,3)4)16-15(5)6-7-20(17,18)10-15/h11-13,16H,6-10H2,1-5H3.
What are the key properties of N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine?
N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 303.47 g/mol, XLogP of 1.99, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-3-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 64852345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).