About 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane
2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane (PubChem CID 64852392) has the molecular formula C15H27F3N2O
and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane.
Molecular Properties
| Compound Name | 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane |
| PubChem CID | 64852392 |
| Molecular Formula | C15H27F3N2O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane |
| SMILES | FC(F)(F)COCCN1CCCCCC1C1CCNCC1 |
| InChI | InChI=1S/C15H27F3N2O/c16-15(17,18)12-21-11-10-20-9-3-1-2-4-14(20)13-5-7-19-8-6-13/h13-14,19H,1-12H2 |
| InChIKey | ZFECFEATEXGBAF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane?
The IUPAC name of 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane (CID 64852392) is 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane.
What is the SMILES notation for 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane?
The canonical SMILES for 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane is FC(F)(F)COCCN1CCCCCC1C1CCNCC1.
What is the InChIKey of 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane?
The InChIKey is ZFECFEATEXGBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27F3N2O/c16-15(17,18)12-21-11-10-20-9-3-1-2-4-14(20)13-5-7-19-8-6-13/h13-14,19H,1-12H2.
What are the key properties of 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane?
2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane has a molecular weight of 308.39 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane is sourced from PubChem (CID 64852392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).