About N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline
N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline (PubChem CID 64852690) has the molecular formula C15H20F3NOS
and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline.
Molecular Properties
| Compound Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline |
| PubChem CID | 64852690 |
| Molecular Formula | C15H20F3NOS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline |
| SMILES | CCOC1CC(Nc2ccccc2SC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C15H20F3NOS/c1-4-20-13-9-12(14(13,2)3)19-10-7-5-6-8-11(10)21-15(16,17)18/h5-8,12-13,19H,4,9H2,1-3H3 |
| InChIKey | BTNRUCIBRGELPF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline?
The IUPAC name of N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline (CID 64852690) is N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline.
What is the SMILES notation for N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline?
The canonical SMILES for N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline is CCOC1CC(Nc2ccccc2SC(F)(F)F)C1(C)C.
What is the InChIKey of N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline?
The InChIKey is BTNRUCIBRGELPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F3NOS/c1-4-20-13-9-12(14(13,2)3)19-10-7-5-6-8-11(10)21-15(16,17)18/h5-8,12-13,19H,4,9H2,1-3H3.
What are the key properties of N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline?
N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline has a molecular weight of 319.39 g/mol, XLogP of 4.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethoxy-2,2-dimethylcyclobutyl)-2-(trifluoromethylsulfanyl)aniline is sourced from PubChem (CID 64852690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).