About 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea
1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea (PubChem CID 648529) has the molecular formula C22H33N3O3
and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea.
Molecular Properties
| Compound Name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea |
| PubChem CID | 648529 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea |
| SMILES | CCOCCCN(Cc1cc2cc(C)cc(C)c2[nH]c1=O)C(=O)N(CC)CC |
| InChI | InChI=1S/C22H33N3O3/c1-6-24(7-2)22(27)25(10-9-11-28-8-3)15-19-14-18-13-16(4)12-17(5)20(18)23-21(19)26/h12-14H,6-11,15H2,1-5H3,(H,23,26) |
| InChIKey | CKPXLXBRKAINGX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea?
The IUPAC name of 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea (CID 648529) is 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea.
What is the SMILES notation for 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea?
The canonical SMILES for 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea is CCOCCCN(Cc1cc2cc(C)cc(C)c2[nH]c1=O)C(=O)N(CC)CC.
What is the InChIKey of 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea?
The InChIKey is CKPXLXBRKAINGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33N3O3/c1-6-24(7-2)22(27)25(10-9-11-28-8-3)15-19-14-18-13-16(4)12-17(5)20(18)23-21(19)26/h12-14H,6-11,15H2,1-5H3,(H,23,26).
What are the key properties of 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea?
1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea has a molecular weight of 387.52 g/mol, XLogP of 3.84, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-ethoxypropyl)-3,3-diethylurea is sourced from PubChem (CID 648529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).