About 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine
4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (PubChem CID 6485297) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
Analyze 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
The IUPAC name of 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (CID 6485297) is 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
What is the SMILES notation for 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
The canonical SMILES for 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine is c1cc2c(s1)CCNC2C1CC1.
What is the InChIKey of 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
The InChIKey is YLISNFNPLLPBMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c1-2-7(1)10-8-4-6-12-9(8)3-5-11-10/h4,6-7,10-11H,1-3,5H2.
What are the key properties of 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine has a molecular weight of 179.29 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine is sourced from PubChem (CID 6485297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).