C13H13NS — CID 6485298
4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (PubChem CID 6485298) has the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. Its IUPAC name is 4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
| Compound Name | 4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 6485298 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| SMILES | c1ccc(C2NCCc3sccc32)cc1 |
| InChI | InChI=1S/C13H13NS/c1-2-4-10(5-3-1)13-11-7-9-15-12(11)6-8-14-13/h1-5,7,9,13-14H,6,8H2 |
| InChIKey | BKXOJOFWZSFANH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |