About 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide
2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide (PubChem CID 6485361) has the molecular formula C7H10ClN3O
and a molecular weight of 187.63 g/mol. Its IUPAC name is 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide |
| PubChem CID | 6485361 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CCl)nn1C |
| InChI | InChI=1S/C7H10ClN3O/c1-5-3-6(10-11(5)2)9-7(12)4-8/h3H,4H2,1-2H3,(H,9,10,12) |
| InChIKey | LFPUCTWUHNJOKC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide?
The IUPAC name of 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide (CID 6485361) is 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide.
What is the SMILES notation for 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide?
The canonical SMILES for 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide is Cc1cc(NC(=O)CCl)nn1C.
What is the InChIKey of 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide?
The InChIKey is LFPUCTWUHNJOKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3O/c1-5-3-6(10-11(5)2)9-7(12)4-8/h3H,4H2,1-2H3,(H,9,10,12).
What are the key properties of 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide?
2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide has a molecular weight of 187.63 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(1,5-dimethylpyrazol-3-yl)acetamide is sourced from PubChem (CID 6485361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).