C14H18N4 — CID 64853991
N,N-dimethyl-4-(4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)aniline (PubChem CID 64853991) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is N,N-dimethyl-4-(4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)aniline.
| Compound Name | N,N-dimethyl-4-(4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)aniline |
|---|---|
| PubChem CID | 64853991 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | N,N-dimethyl-4-(4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)aniline |
| SMILES | CN(C)c1ccc(-n2cnc3c2CCNC3)cc1 |
| InChI | InChI=1S/C14H18N4/c1-17(2)11-3-5-12(6-4-11)18-10-16-13-9-15-8-7-14(13)18/h3-6,10,15H,7-9H2,1-2H3 |
| InChIKey | MJZXJIDHANYRRX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|