About 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine
1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 64854182) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
Analyze 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine?
The IUPAC name of 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (CID 64854182) is 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
What is the SMILES notation for 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine?
The canonical SMILES for 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine is c1nc2c(n1C1CCC1)CCNC2.
What is the InChIKey of 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine?
The InChIKey is FZYKSNSEDOBDQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-2-8(3-1)13-7-12-9-6-11-5-4-10(9)13/h7-8,11H,1-6H2.
What are the key properties of 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine?
1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine has a molecular weight of 177.25 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine is sourced from PubChem (CID 64854182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).