About 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene
1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene (PubChem CID 64854914) has the molecular formula C17H17FO2
and a molecular weight of 272.32 g/mol. Its IUPAC name is 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene |
| PubChem CID | 64854914 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene |
| SMILES | Cc1ccc(F)c(OCC2OCCc3ccccc32)c1 |
| InChI | InChI=1S/C17H17FO2/c1-12-6-7-15(18)16(10-12)20-11-17-14-5-3-2-4-13(14)8-9-19-17/h2-7,10,17H,8-9,11H2,1H3 |
| InChIKey | MXXHGUWHLSYKDE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene?
The IUPAC name of 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene (CID 64854914) is 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene?
The canonical SMILES for 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene is Cc1ccc(F)c(OCC2OCCc3ccccc32)c1.
What is the InChIKey of 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene?
The InChIKey is MXXHGUWHLSYKDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FO2/c1-12-6-7-15(18)16(10-12)20-11-17-14-5-3-2-4-13(14)8-9-19-17/h2-7,10,17H,8-9,11H2,1H3.
What are the key properties of 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene?
1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene has a molecular weight of 272.32 g/mol, XLogP of 3.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-fluoro-5-methylphenoxy)methyl]-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 64854914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).