C11H7F3N2O3S — CID 648553
2-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 648553) has the molecular formula C11H7F3N2O3S and a molecular weight of 304.25 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 648553 |
| Molecular Formula | C11H7F3N2O3S |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 2-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)CSC1=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H7F3N2O3S/c12-5-1-2-6(10(14)9(5)13)15-7(17)3-16-8(18)4-20-11(16)19/h1-2H,3-4H2,(H,15,17) |
| InChIKey | LIUSCLYEBGVJRP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|