C20H18FN3O4S — CID 648556
3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-N-methyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 648556) has the molecular formula C20H18FN3O4S and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-N-methyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-N-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 648556 |
| Molecular Formula | C20H18FN3O4S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-N-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CNC(=O)C1CC(=O)N(Cc2ccc3c(c2)OCO3)/C(=N/c2ccc(F)cc2)S1 |
| InChI | InChI=1S/C20H18FN3O4S/c1-22-19(26)17-9-18(25)24(10-12-2-7-15-16(8-12)28-11-27-15)20(29-17)23-14-5-3-13(21)4-6-14/h2-8,17H,9-11H2,1H3,(H,22,26)/b23-20- |
| InChIKey | CFQHWPNPVPDKNP-ATJXCDBQSA-N |
| XLogP | 2.82 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|