C13H21N3 — CID 64856291
1-cycloheptyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 64856291) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-cycloheptyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 1-cycloheptyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 64856291 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1-cycloheptyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | c1nc2c(n1C1CCCCCC1)CCNC2 |
| InChI | InChI=1S/C13H21N3/c1-2-4-6-11(5-3-1)16-10-15-12-9-14-8-7-13(12)16/h10-11,14H,1-9H2 |
| InChIKey | QARZKLCHJDZPQE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |