C16H27N3O — CID 64856419
2-cyclopropyl-1-[2-(3-methylbutoxy)ethyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 64856419) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-cyclopropyl-1-[2-(3-methylbutoxy)ethyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-cyclopropyl-1-[2-(3-methylbutoxy)ethyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 64856419 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 2-cyclopropyl-1-[2-(3-methylbutoxy)ethyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | CC(C)CCOCCn1c(C2CC2)nc2c1CCNC2 |
| InChI | InChI=1S/C16H27N3O/c1-12(2)6-9-20-10-8-19-15-5-7-17-11-14(15)18-16(19)13-3-4-13/h12-13,17H,3-11H2,1-2H3 |
| InChIKey | WVQJLKLSBNZDRU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|