C14H22F3N3O — CID 64856806
1-[2-(3-methylbutoxy)ethyl]-2-(trifluoromethyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 64856806) has the molecular formula C14H22F3N3O and a molecular weight of 305.34 g/mol. Its IUPAC name is 1-[2-(3-methylbutoxy)ethyl]-2-(trifluoromethyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 1-[2-(3-methylbutoxy)ethyl]-2-(trifluoromethyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 64856806 |
| Molecular Formula | C14H22F3N3O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[2-(3-methylbutoxy)ethyl]-2-(trifluoromethyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | CC(C)CCOCCn1c(C(F)(F)F)nc2c1CCNC2 |
| InChI | InChI=1S/C14H22F3N3O/c1-10(2)4-7-21-8-6-20-12-3-5-18-9-11(12)19-13(20)14(15,16)17/h10,18H,3-9H2,1-2H3 |
| InChIKey | MZKZISOPNYCRQE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|