C18H17N3 — CID 64856821
1,2-diphenyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 64856821) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 1,2-diphenyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 1,2-diphenyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 64856821 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1,2-diphenyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | c1ccc(-c2nc3c(n2-c2ccccc2)CCNC3)cc1 |
| InChI | InChI=1S/C18H17N3/c1-3-7-14(8-4-1)18-20-16-13-19-12-11-17(16)21(18)15-9-5-2-6-10-15/h1-10,19H,11-13H2 |
| InChIKey | JDKATPSOYDUYCD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |