C16H20N4 — CID 64856886
1-(4-pyrrolidin-1-ylphenyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 64856886) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(4-pyrrolidin-1-ylphenyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 1-(4-pyrrolidin-1-ylphenyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 64856886 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-(4-pyrrolidin-1-ylphenyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | c1cc(-n2cnc3c2CCNC3)ccc1N1CCCC1 |
| InChI | InChI=1S/C16H20N4/c1-2-10-19(9-1)13-3-5-14(6-4-13)20-12-18-15-11-17-8-7-16(15)20/h3-6,12,17H,1-2,7-11H2 |
| InChIKey | GONXNQTURMOEPC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|