C15H14F3N3 — CID 64856960
2-cyclopropyl-1-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 64856960) has the molecular formula C15H14F3N3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-cyclopropyl-1-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-cyclopropyl-1-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 64856960 |
| Molecular Formula | C15H14F3N3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-cyclopropyl-1-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Fc1cc(F)c(F)c(-n2c(C3CC3)nc3c2CCNC3)c1 |
| InChI | InChI=1S/C15H14F3N3/c16-9-5-10(17)14(18)13(6-9)21-12-3-4-19-7-11(12)20-15(21)8-1-2-8/h5-6,8,19H,1-4,7H2 |
| InChIKey | FZKUTIKFLQYDKQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|