C18H28N2 — CID 64857077
1-(cyclohexylmethyl)-3-phenyl-1,4-diazepane (PubChem CID 64857077) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-phenyl-1,4-diazepane.
| Compound Name | 1-(cyclohexylmethyl)-3-phenyl-1,4-diazepane |
|---|---|
| PubChem CID | 64857077 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-phenyl-1,4-diazepane |
| SMILES | c1ccc(C2CN(CC3CCCCC3)CCCN2)cc1 |
| InChI | InChI=1S/C18H28N2/c1-3-8-16(9-4-1)14-20-13-7-12-19-18(15-20)17-10-5-2-6-11-17/h2,5-6,10-11,16,18-19H,1,3-4,7-9,12-15H2 |
| InChIKey | STIIAEULUSJPDT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |