About 11-nonyl-7,11-diazaspiro[5.6]dodecane
11-nonyl-7,11-diazaspiro[5.6]dodecane (PubChem CID 64857646) has the molecular formula C19H38N2
and a molecular weight of 294.53 g/mol. Its IUPAC name is 11-nonyl-7,11-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 11-nonyl-7,11-diazaspiro[5.6]dodecane |
| PubChem CID | 64857646 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | 11-nonyl-7,11-diazaspiro[5.6]dodecane |
| SMILES | CCCCCCCCCN1CCCNC2(CCCCC2)C1 |
| InChI | InChI=1S/C19H38N2/c1-2-3-4-5-6-7-11-16-21-17-12-15-20-19(18-21)13-9-8-10-14-19/h20H,2-18H2,1H3 |
| InChIKey | LYUXGIQHOKPKRY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-nonyl-7,11-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-nonyl-7,11-diazaspiro[5.6]dodecane?
The IUPAC name of 11-nonyl-7,11-diazaspiro[5.6]dodecane (CID 64857646) is 11-nonyl-7,11-diazaspiro[5.6]dodecane.
What is the SMILES notation for 11-nonyl-7,11-diazaspiro[5.6]dodecane?
The canonical SMILES for 11-nonyl-7,11-diazaspiro[5.6]dodecane is CCCCCCCCCN1CCCNC2(CCCCC2)C1.
What is the InChIKey of 11-nonyl-7,11-diazaspiro[5.6]dodecane?
The InChIKey is LYUXGIQHOKPKRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38N2/c1-2-3-4-5-6-7-11-16-21-17-12-15-20-19(18-21)13-9-8-10-14-19/h20H,2-18H2,1H3.
What are the key properties of 11-nonyl-7,11-diazaspiro[5.6]dodecane?
11-nonyl-7,11-diazaspiro[5.6]dodecane has a molecular weight of 294.53 g/mol, XLogP of 4.74, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-nonyl-7,11-diazaspiro[5.6]dodecane is sourced from PubChem (CID 64857646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).