C14H26N4 — CID 64858249
N,N,4-trimethyl-2-(4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)pentan-1-amine (PubChem CID 64858249) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is N,N,4-trimethyl-2-(4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)pentan-1-amine.
| Compound Name | N,N,4-trimethyl-2-(4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)pentan-1-amine |
|---|---|
| PubChem CID | 64858249 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | N,N,4-trimethyl-2-(4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)pentan-1-amine |
| SMILES | CC(C)CC(CN(C)C)n1cnc2c1CCNC2 |
| InChI | InChI=1S/C14H26N4/c1-11(2)7-12(9-17(3)4)18-10-16-13-8-15-6-5-14(13)18/h10-12,15H,5-9H2,1-4H3 |
| InChIKey | KJXDWKQHPOTSKU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |