C11H21F3N2 — CID 64858430
3-butan-2-yl-1-(2,2,2-trifluoroethyl)-1,4-diazepane (PubChem CID 64858430) has the molecular formula C11H21F3N2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 3-butan-2-yl-1-(2,2,2-trifluoroethyl)-1,4-diazepane.
| Compound Name | 3-butan-2-yl-1-(2,2,2-trifluoroethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64858430 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 3-butan-2-yl-1-(2,2,2-trifluoroethyl)-1,4-diazepane |
| SMILES | CCC(C)C1CN(CC(F)(F)F)CCCN1 |
| InChI | InChI=1S/C11H21F3N2/c1-3-9(2)10-7-16(6-4-5-15-10)8-11(12,13)14/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | CMNSFIIEEMQYTM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |