About 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane
1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane (PubChem CID 64858810) has the molecular formula C8H16F2N2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane |
| PubChem CID | 64858810 |
| Molecular Formula | C8H16F2N2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane |
| SMILES | CC1CN(CC(F)F)CCCN1 |
| InChI | InChI=1S/C8H16F2N2/c1-7-5-12(6-8(9)10)4-2-3-11-7/h7-8,11H,2-6H2,1H3 |
| InChIKey | RTWZOCDIXKUFMT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane?
The IUPAC name of 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane (CID 64858810) is 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane.
What is the SMILES notation for 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane?
The canonical SMILES for 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane is CC1CN(CC(F)F)CCCN1.
What is the InChIKey of 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane?
The InChIKey is RTWZOCDIXKUFMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2/c1-7-5-12(6-8(9)10)4-2-3-11-7/h7-8,11H,2-6H2,1H3.
What are the key properties of 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane?
1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane has a molecular weight of 178.23 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-3-methyl-1,4-diazepane is sourced from PubChem (CID 64858810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).