About methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate
methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate (PubChem CID 6485996) has the molecular formula C12H13Cl2NO2
and a molecular weight of 274.15 g/mol. Its IUPAC name is methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate |
| PubChem CID | 6485996 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN[C@@H]1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H13Cl2NO2/c1-17-12(16)7-5-6-15-11(7)10-8(13)3-2-4-9(10)14/h2-4,7,11,15H,5-6H2,1H3/t7-,11+/m1/s1 |
| InChIKey | OJCNQXAYXHHTBC-HQJQHLMTSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate?
The IUPAC name of methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate (CID 6485996) is methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate.
What is the SMILES notation for methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate?
The canonical SMILES for methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate is COC(=O)[C@@H]1CCN[C@@H]1c1c(Cl)cccc1Cl.
What is the InChIKey of methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate?
The InChIKey is OJCNQXAYXHHTBC-HQJQHLMTSA-N. The full InChI is InChI=1S/C12H13Cl2NO2/c1-17-12(16)7-5-6-15-11(7)10-8(13)3-2-4-9(10)14/h2-4,7,11,15H,5-6H2,1H3/t7-,11+/m1/s1.
What are the key properties of methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate?
methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate has a molecular weight of 274.15 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3R)-2-(2,6-dichlorophenyl)pyrrolidine-3-carboxylate is sourced from PubChem (CID 6485996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).