C19H40N2 — CID 64860045
5,5-diethyl-1-octyl-2-propan-2-ylpiperazine (PubChem CID 64860045) has the molecular formula C19H40N2 and a molecular weight of 296.54 g/mol. Its IUPAC name is 5,5-diethyl-1-octyl-2-propan-2-ylpiperazine.
| Compound Name | 5,5-diethyl-1-octyl-2-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 64860045 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | 5,5-diethyl-1-octyl-2-propan-2-ylpiperazine |
| SMILES | CCCCCCCCN1CC(CC)(CC)NCC1C(C)C |
| InChI | InChI=1S/C19H40N2/c1-6-9-10-11-12-13-14-21-16-19(7-2,8-3)20-15-18(21)17(4)5/h17-18,20H,6-16H2,1-5H3 |
| InChIKey | NBBJOPNMDBOLRU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|