About 5-amino-1,3,6-trimethylbenzimidazol-2-one
5-amino-1,3,6-trimethylbenzimidazol-2-one (PubChem CID 6486007) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 5-amino-1,3,6-trimethylbenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-amino-1,3,6-trimethylbenzimidazol-2-one |
| PubChem CID | 6486007 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 5-amino-1,3,6-trimethylbenzimidazol-2-one |
| SMILES | Cc1cc2c(cc1N)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H13N3O/c1-6-4-8-9(5-7(6)11)13(3)10(14)12(8)2/h4-5H,11H2,1-3H3 |
| InChIKey | DHPXTEFKFUCWDK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1,3,6-trimethylbenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,3,6-trimethylbenzimidazol-2-one?
The IUPAC name of 5-amino-1,3,6-trimethylbenzimidazol-2-one (CID 6486007) is 5-amino-1,3,6-trimethylbenzimidazol-2-one.
What is the SMILES notation for 5-amino-1,3,6-trimethylbenzimidazol-2-one?
The canonical SMILES for 5-amino-1,3,6-trimethylbenzimidazol-2-one is Cc1cc2c(cc1N)n(C)c(=O)n2C.
What is the InChIKey of 5-amino-1,3,6-trimethylbenzimidazol-2-one?
The InChIKey is DHPXTEFKFUCWDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-6-4-8-9(5-7(6)11)13(3)10(14)12(8)2/h4-5H,11H2,1-3H3.
What are the key properties of 5-amino-1,3,6-trimethylbenzimidazol-2-one?
5-amino-1,3,6-trimethylbenzimidazol-2-one has a molecular weight of 191.23 g/mol, XLogP of 0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3,6-trimethylbenzimidazol-2-one is sourced from PubChem (CID 6486007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).