C16H22F2N2 — CID 64860967
2-cyclopropyl-1-(2,2-difluoroethyl)-5-methyl-5-phenylpiperazine (PubChem CID 64860967) has the molecular formula C16H22F2N2 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-cyclopropyl-1-(2,2-difluoroethyl)-5-methyl-5-phenylpiperazine.
| Compound Name | 2-cyclopropyl-1-(2,2-difluoroethyl)-5-methyl-5-phenylpiperazine |
|---|---|
| PubChem CID | 64860967 |
| Molecular Formula | C16H22F2N2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-cyclopropyl-1-(2,2-difluoroethyl)-5-methyl-5-phenylpiperazine |
| SMILES | CC1(c2ccccc2)CN(CC(F)F)C(C2CC2)CN1 |
| InChI | InChI=1S/C16H22F2N2/c1-16(13-5-3-2-4-6-13)11-20(10-15(17)18)14(9-19-16)12-7-8-12/h2-6,12,14-15,19H,7-11H2,1H3 |
| InChIKey | LYUDPWJRTLYVSU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |