About 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine
5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine (PubChem CID 64861167) has the molecular formula C17H28N2S
and a molecular weight of 292.49 g/mol. Its IUPAC name is 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine.
Molecular Properties
| Compound Name | 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine |
| PubChem CID | 64861167 |
| Molecular Formula | C17H28N2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine |
| SMILES | CC1(C)CNC(C2CCCCC2)CN1Cc1cccs1 |
| InChI | InChI=1S/C17H28N2S/c1-17(2)13-18-16(14-7-4-3-5-8-14)12-19(17)11-15-9-6-10-20-15/h6,9-10,14,16,18H,3-5,7-8,11-13H2,1-2H3 |
| InChIKey | CLSVYJRLIPVMRS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine?
The IUPAC name of 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine (CID 64861167) is 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine.
What is the SMILES notation for 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine?
The canonical SMILES for 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine is CC1(C)CNC(C2CCCCC2)CN1Cc1cccs1.
What is the InChIKey of 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine?
The InChIKey is CLSVYJRLIPVMRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2S/c1-17(2)13-18-16(14-7-4-3-5-8-14)12-19(17)11-15-9-6-10-20-15/h6,9-10,14,16,18H,3-5,7-8,11-13H2,1-2H3.
What are the key properties of 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine?
5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine has a molecular weight of 292.49 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-2,2-dimethyl-1-(thiophen-2-ylmethyl)piperazine is sourced from PubChem (CID 64861167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).