About N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide
N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide (PubChem CID 6486186) has the molecular formula C15H19N3O3S
and a molecular weight of 321.40 g/mol. Its IUPAC name is N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide |
| PubChem CID | 6486186 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide |
| SMILES | CCn1c(=O)c2sccc2n(CC(=O)NC2CCCC2)c1=O |
| InChI | InChI=1S/C15H19N3O3S/c1-2-17-14(20)13-11(7-8-22-13)18(15(17)21)9-12(19)16-10-5-3-4-6-10/h7-8,10H,2-6,9H2,1H3,(H,16,19) |
| InChIKey | CESRPBGLKHDHAL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide?
The IUPAC name of N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide (CID 6486186) is N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide.
What is the SMILES notation for N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide?
The canonical SMILES for N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide is CCn1c(=O)c2sccc2n(CC(=O)NC2CCCC2)c1=O.
What is the InChIKey of N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide?
The InChIKey is CESRPBGLKHDHAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3S/c1-2-17-14(20)13-11(7-8-22-13)18(15(17)21)9-12(19)16-10-5-3-4-6-10/h7-8,10H,2-6,9H2,1H3,(H,16,19).
What are the key properties of N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide?
N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide has a molecular weight of 321.40 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-(3-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)acetamide is sourced from PubChem (CID 6486186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).