About 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine
2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine (PubChem CID 64862368) has the molecular formula C14H28F2N2
and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine.
Molecular Properties
| Compound Name | 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine |
| PubChem CID | 64862368 |
| Molecular Formula | C14H28F2N2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine |
| SMILES | CCC1(CC)CN(CC(F)F)C(C(C)(C)C)CN1 |
| InChI | InChI=1S/C14H28F2N2/c1-6-14(7-2)10-18(9-12(15)16)11(8-17-14)13(3,4)5/h11-12,17H,6-10H2,1-5H3 |
| InChIKey | RFSVGCGKVYPUCG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine?
The IUPAC name of 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine (CID 64862368) is 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine.
What is the SMILES notation for 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine?
The canonical SMILES for 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine is CCC1(CC)CN(CC(F)F)C(C(C)(C)C)CN1.
What is the InChIKey of 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine?
The InChIKey is RFSVGCGKVYPUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28F2N2/c1-6-14(7-2)10-18(9-12(15)16)11(8-17-14)13(3,4)5/h11-12,17H,6-10H2,1-5H3.
What are the key properties of 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine?
2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine has a molecular weight of 262.39 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-(2,2-difluoroethyl)-5,5-diethylpiperazine is sourced from PubChem (CID 64862368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).